Compound Detail
CHEMBL4214282
Enter ChEMBL ID:
Free Research Context
This compound will appear in recent viewed items on the research home for this browser.
Research home
View demo workspace
CC[Si](CC)(CC)c1ccc(N2[C@H](c3ccc(NC(=O)[C@@H]4CCCN4C(=O)[C@@H](NC(=O)OC)C(C)C)cc3)CC[C@H]2c2ccc(NC(=O)[C@@H]3CCCN3C(=O)[C@@H](NC(=O)OC)C(C)C)cc2)cc1
Basic Information
| ChEMBL ID | CHEMBL4214282 |
| Phase | Preclinical |
| Structure Type | MOL |
| InChI Key | CZTPXCSBMCSWAB-JSHGGYKJSA-N |
2
Targets
11
Activities
1
Assay Types
8
PK Parameters
16
Publications
0
Known Names
Molecular Properties
952.3
MW (Da)
Drug Information
| Molecule Type | Small molecule |
| Availability | Unknown |
| Chirality | Unknown |
Activity Summary
EC50 11 meas. best 11.0
Target Activity Profile
| Target | Type | Best pChEMBL | Mean pChEMBL | Best (nM) | # Data |
|---|---|---|---|---|---|
| Nonstructural protein 5A CHEMBL3307224 | EC50 | 11.0 | 10.175 | 0.0 | 2 |
| Hepatitis C virus CHEMBL379 | EC50 | 10.96 | 10.025 | 0.0 | 2 |
Pharmacokinetic Data
| Parameter | Value | Units | Species |
|---|---|---|---|
| AUC | 3041.0 | ng.hr.mL-1 | Mus musculus |
| AUC | 604.7 | ng.hr.mL-1 | Canis lupus familiaris |
| Cmax | 208.13 | nM | Mus musculus |
| Cmax | 30.64 | nM | Canis lupus familiaris |
| T1/2 | 22.5 | hr | Mus musculus |
| T1/2 | 12.7 | hr | Canis lupus familiaris |
| Tmax | 3.0 | hr | Mus musculus |
| Tmax | 10.5 | hr | Canis lupus familiaris |
Activity Data Samples
Top measurements by pChEMBL value
| Target | Type | Rel. | Value | Units | pChEMBL | Assay | PubMed |
|---|---|---|---|---|---|---|---|
| Nonstructural protein 5A | EC50 | = | 0.01 | nM | 11.0 | Inhibition of NS5A in HCV genotype 3a infected in human HuH7 replicon cells expr... | 29454920 |
| Hepatitis C virus | EC50 | = | 0.011 | nM | 10.96 | Antiviral activity against Hepatitis C virus subtype 1a H77 subgenomic replicon ... | 32293179 |
| Nonstructural protein 5A | EC50 | = | 0.445 | nM | 9.35 | Inhibition of NS5A in HCV genotype 6a infected in human HuH7 replicon cells expr... | 29454920 |
| Hepatitis C virus | EC50 | = | 0.817 | nM | 9.09 | Antiviral activity against Hepatitis C virus subtype 6a subgenomic replicon expr... | 32293179 |
Literature References
| PubMed | DOI | Target Context | # Activities |
|---|---|---|---|
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Mus musculus | 40 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | ADMET | 18 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Nonstructural protein 5A | 8 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Canis familiaris | 4 |
| 32293179 | 10.1021/acs.jmedchem.0c00082 | Hepatitis C virus | 4 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Cytochrome P450 3A4 | 2 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Voltage-gated inwardly rectifying potassium channel KCNH2 | 2 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Huh-7 | 1 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Genome polyprotein | 1 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | HUVEC | 1 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Cytochrome P450 2D6 | 1 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Cytochrome P450 2C19 | 1 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Cytochrome P450 2C9 | 1 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Cytochrome P450 2B6 | 1 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Cytochrome P450 1A2 | 1 |
| 29454920 | 10.1016/j.ejmech.2018.02.025 | Cytochrome P450 2A6 | 1 |
Data from ChEMBL 36 via Core Engine