Compound Detail
CHEMBL2181022
Enter ChEMBL ID:
Free Research Context
This compound will appear in recent viewed items on the research home for this browser.
Research home
View demo workspace
COC(=O)[C@@H]1CCCN1C(=O)[C@@H](Cc1ccccc1)N(C)C(=O)[C@H](C)NC(=O)[C@H](CC(C)C)NC(=O)C[C@H](O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCC(N)=O)N(C)C(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C
Basic Information
| ChEMBL ID | CHEMBL2181022 |
| Phase | Preclinical |
| Structure Type | MOL |
| InChI Key | NXDIWJUYMKBICN-QDBLDGTHSA-N |
3
Targets
7
Activities
1
Assay Types
0
PK Parameters
12
Publications
0
Known Names
Molecular Properties
1041.3
MW (Da)
Drug Information
| Molecule Type | Small molecule |
| Availability | Unknown |
| Chirality | Unknown |
Activity Summary
IC50 7 meas. best 10.11
Target Activity Profile
| Target | Type | Best pChEMBL | Mean pChEMBL | Best (nM) | # Data |
|---|---|---|---|---|---|
| Cathepsin D CHEMBL2581 | IC50 | 10.11 | 10.11 | 0.1 | 2 |
| Cathepsin E CHEMBL3092 | IC50 | 9.14 | 9.14 | 0.7 | 2 |
| Beta-secretase 1 CHEMBL4822 | IC50 | 7.27 | 7.27 | 54.2 | 3 |
Activity Data Samples
Top measurements by pChEMBL value
| Target | Type | Rel. | Value | Units | pChEMBL | Assay | PubMed |
|---|---|---|---|---|---|---|---|
| Cathepsin D | IC50 | = | 0.0783 | nM | 10.11 | Inhibition of cathepsin D by fluorescence assay | 23181502 |
| Cathepsin D | IC50 | = | 0.0783 | nM | 10.11 | Inhibition of recombinant human liver Cathepsin D using Mca-Gly-Lys-Pro-Ile-Leu-... | 35121401 |
| Cathepsin E | IC50 | = | 0.724 | nM | 9.14 | Inhibition of cathepsin E by fluorescence assay | 23181502 |
| Cathepsin E | IC50 | = | 0.724 | nM | 9.14 | Inhibition of Cathepsin E (unknown origin) using Mca-Gly-Lys-Pro-Ile-Leu-Phe-Phe... | 35121401 |
| Beta-secretase 1 | IC50 | = | 54.2 | nM | 7.27 | Inhibition of BACE1 by fluorescence assay | 23181502 |
| Beta-secretase 1 | IC50 | = | 54.2 | nM | 7.27 | Inhibition of BACE1 (unknown origin) after 90 mins by fluorescence assay | 25842365 |
| Beta-secretase 1 | IC50 | = | 54.2 | nM | 7.27 | Inhibition of BACE1 (unknown origin) using Mca-Ser-Glu-Val-Asn-Leu-Asp-Ala-Glu-P... | 35121401 |
Literature References
| PubMed | DOI | Target Context | # Activities |
|---|---|---|---|
| 23181502 | 10.1021/jm301630s | Beta-secretase 1 | 2 |
| 35121401 | 10.1016/j.bmc.2022.116646 | MDA-MB-231 | 2 |
| 23181502 | 10.1021/jm301630s | Gamma-secretase | 1 |
| 23181502 | 10.1021/jm301630s | Unchecked | 1 |
| 23181502 | 10.1021/jm301630s | Cathepsin E | 1 |
| 23181502 | 10.1021/jm301630s | Cathepsin D | 1 |
| 25842365 | 10.1016/j.bmc.2015.03.034 | Beta-secretase 1 | 1 |
| 35121401 | 10.1016/j.bmc.2022.116646 | Cathepsin D | 1 |
| 35121401 | 10.1016/j.bmc.2022.116646 | Cathepsin E | 1 |
| 35121401 | 10.1016/j.bmc.2022.116646 | Beta-secretase 1 | 1 |
| 35121401 | 10.1016/j.bmc.2022.116646 | A549 | 1 |
| 35121401 | 10.1016/j.bmc.2022.116646 | HepG2 | 1 |
Data from ChEMBL 36 via Core Engine