Compound Detail
CHEMBL5431856
Enter ChEMBL ID:
Free Research Context
This compound will appear in recent viewed items on the research home for this browser.
Research home
View demo workspace
CC(C)(C)NC(=O)C[C@H](NC(=O)C(=O)c1c[nH]c2ccccc12)C(=O)NCc1cccc(B(O)O)c1
Basic Information
| ChEMBL ID | CHEMBL5431856 |
| Phase | Preclinical |
| Structure Type | MOL |
| InChI Key | ATSWPXLAIPHFLB-FQEVSTJZSA-N |
5
Targets
7
Activities
2
Assay Types
0
PK Parameters
14
Publications
0
Known Names
Molecular Properties
492.3
MW (Da)
Drug Information
| Availability | Unknown |
| Chirality | Unknown |
Activity Summary
EC50 5 meas. best 8.0
IC50 2 meas. best 8.0
Target Activity Profile
| Target | Type | Best pChEMBL | Mean pChEMBL | Best (nM) | # Data |
|---|---|---|---|---|---|
| MM1.S CHEMBL4296471 | EC50 | 8.0 | 7.62 | 10.0 | 2 |
| Proteasome Macropain subunit MB1 CHEMBL4662 | IC50 | 8.0 | 8.0 | 10.0 | 1 |
| RPMI-8226 CHEMBL614882 | EC50 | 6.76 | 6.27 | 173.0 | 2 |
| HepG2 CHEMBL395 | EC50 | 5.5 | 5.5 | 3200.0 | 1 |
| Proteasome subunit beta type-8 CHEMBL5620 | IC50 | 5.15 | 5.15 | 7100.0 | 1 |
Activity Data Samples
Top measurements by pChEMBL value
| Target | Type | Rel. | Value | Units | pChEMBL | Assay | PubMed |
|---|---|---|---|---|---|---|---|
| MM1.S | EC50 | = | 10.0 | nM | 8.0 | Synergistic cytotoxic activity against human MM1.S cells after 72 hrs in presenc... | 36608337 |
| Proteasome Macropain subunit MB1 | IC50 | = | 10.0 | nM | 8.0 | Inhibition of human 20s constitutive proteasome beta-5c | 36608337 |
| MM1.S | EC50 | = | 57.0 | nM | 7.24 | Cytotoxicity against human MM1.S cells after 72 hrs by celltitre-glo assay | 36608337 |
| RPMI-8226 | EC50 | = | 173.0 | nM | 6.76 | Synergistic cytotoxic activity against human RPMI-8226 cells after 72 hrs in pre... | 36608337 |
| RPMI-8226 | EC50 | = | 1670.0 | nM | 5.78 | Cytotoxicity against human RPMI-8226 cells after 72 hrs by celltitre-glo assay | 36608337 |
| HepG2 | EC50 | = | 3200.0 | nM | 5.5 | Cytotoxicity against human HepG2 cells after 72 hrs by celltitre-glo assay | 36608337 |
| Proteasome subunit beta type-8 | IC50 | = | 7100.0 | nM | 5.15 | Inhibition of human 20s immunoproteasome beta-5i subunit | 36608337 |
Literature References
| PubMed | DOI | Target Context | # Activities |
|---|---|---|---|
| 36608337 | 10.1021/acs.jmedchem.2c00733 | Proteasome Macropain subunit MB1 | 4 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | Proteasome subunit beta type-8 | 3 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | MM1.S | 2 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | RPMI-8226 | 2 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | PBMC | 1 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | Proteasome subunit beta type-9 | 1 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | Proteasome subunit beta type-10 | 1 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | Proteasome component C5 | 1 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | Proteasome Macropain subunit | 1 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | Procathepsin L | 1 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | Trypsin | 1 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | Chymotrypsin | 1 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | HepG2 | 1 |
| 36608337 | 10.1021/acs.jmedchem.2c00733 | Unchecked | 1 |
Data from ChEMBL 36 via Core Engine