Compound Detail
CHEMBL4065973
Enter ChEMBL ID:
Free Research Context
This compound will appear in recent viewed items on the research home for this browser.
Research home
View demo workspace
CCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@H](CO)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CCCCN)C(=O)NC(C)(C)C(=O)N[C@@H](Cc1ccc(Br)cc1)C(=O)O
Basic Information
| ChEMBL ID | CHEMBL4065973 |
| Phase | Preclinical |
| Structure Type | MOL |
| InChI Key | KLQZDNWCYDAAMM-MOBVNWGTSA-N |
2
Targets
6
Activities
3
Assay Types
8
PK Parameters
17
Publications
0
Known Names
Molecular Properties
2201.5
MW (Da)
Drug Information
| Molecule Type | Small molecule |
| Availability | Unknown |
| Chirality | Unknown |
Activity Summary
EC50 3 meas. best 8.56
Ki 2 meas. best 9.35
IC50 1 meas. best 9.22
Target Activity Profile
| Target | Type | Best pChEMBL | Mean pChEMBL | Best (nM) | # Data |
|---|---|---|---|---|---|
| Apelin receptor CHEMBL2398 | Ki | 9.35 | 9.35 | 0.4 | 2 |
| Apelin receptor CHEMBL2398 | IC50 | 9.22 | 9.22 | 0.6 | 1 |
| Apelin receptor CHEMBL1628481 | EC50 | 8.56 | 8.3933 | 2.8 | 3 |
Pharmacokinetic Data
| Parameter | Value | Units | Species |
|---|---|---|---|
| T1/2 | 1.2 | hr | Homo sapiens |
| T1/2 | 0.9 | hr | Homo sapiens |
| T1/2 | 30.0 | hr | Homo sapiens |
| T1/2 | 1.2 | hr | Homo sapiens |
| T1/2 | 0.9 | hr | Mus musculus |
| T1/2 | 48.0 | hr | Homo sapiens |
| T1/2 | 8.29 | hr | Homo sapiens |
| T1/2 | 0.99 | hr | Mus musculus |
Activity Data Samples
Top measurements by pChEMBL value
| Target | Type | Rel. | Value | Units | pChEMBL | Assay | PubMed |
|---|---|---|---|---|---|---|---|
| Apelin receptor | Ki | = | 0.45 | nM | 9.35 | Displacement of [125I]-pyr-1-apelin-13 from rat C-terminal EGFP-tagged APJ recep... | 28685579 |
| Apelin receptor | Ki | = | 0.4467 | nM | 9.35 | Displacement of [125I]-pyr-1-apelin-13 from EGFP tagged rat apelin receptor expr... | 34458742 |
| Apelin receptor | IC50 | = | 0.6026 | nM | 9.22 | Displacement of [125I]-pyr-1-apelin-13 from EGFP-tagged wild-type rat apelin rec... | 33001648 |
| Apelin receptor | EC50 | = | 2.754 | nM | 8.56 | Activation of recombinant human APJ receptor expressed in rat Chem-5 cells asses... | 34458742 |
| Apelin receptor | EC50 | = | 4.9 | nM | 8.31 | Activation of recombinant human APJ expressed in rat Chem5 cells co-expressing G... | 30690406 |
| Apelin receptor | EC50 | = | 4.898 | nM | 8.31 | Activation of APJ receptor (unknown origin) expressed in Chem-5 cells assessed a... | 33001648 |
Literature References
| PubMed | DOI | Target Context | # Activities |
|---|---|---|---|
| 30690406 | 10.1016/j.ejmech.2019.01.040 | Plasma kallikrein | 6 |
| 28685579 | 10.1021/acs.jmedchem.7b00723 | Neprilysin | 4 |
| 28685579 | 10.1021/acs.jmedchem.7b00723 | Heart | 4 |
| 33001648 | 10.1021/acs.jmedchem.0c01395 | ADMET | 4 |
| 34458742 | 10.1039/D1MD00120E | ADMET | 3 |
| 33001648 | 10.1021/acs.jmedchem.0c01395 | Apelin receptor | 3 |
| 34458742 | 10.1039/D1MD00120E | Mus musculus | 2 |
| 34458742 | 10.1039/D1MD00120E | Apelin receptor | 2 |
| 33001648 | 10.1021/acs.jmedchem.0c01395 | Heart | 2 |
| 30690406 | 10.1016/j.ejmech.2019.01.040 | Mus musculus | 2 |
| 30690406 | 10.1016/j.ejmech.2019.01.040 | Apelin receptor | 2 |
| 28685579 | 10.1021/acs.jmedchem.7b00723 | Mus musculus | 2 |
| 33001648 | 10.1021/acs.jmedchem.0c01395 | Mus musculus | 1 |
| 33001648 | 10.1021/acs.jmedchem.0c01395 | No relevant target | 1 |
| 30690406 | 10.1016/j.ejmech.2019.01.040 | Neprilysin | 1 |
| 34458742 | 10.1039/D1MD00120E | Neprilysin | 1 |
| 28685579 | 10.1021/acs.jmedchem.7b00723 | Apelin receptor | 1 |
Data from ChEMBL 36 via Core Engine