Compound Detail
CHEMBL369515
Enter ChEMBL ID:
Free Research Context
This compound will appear in recent viewed items on the research home for this browser.
Research home
View demo workspace
C[C@@H]1C[C@@]2(N=C(N)CS2)C2(O[Si](C)(C)C)O[C@@H]3C[C@@]4(CO)[C@@H](CC[C@@H]5[C@@H]4CC[C@]4(C)[C@@H](C6=CC(=O)OC6)CC[C@]54CO[Si](C)(C)C)C[C@H]3O[C@@H]2O1
Basic Information
| ChEMBL ID | CHEMBL369515 |
| Phase | Preclinical |
| Structure Type | MOL |
| InChI Key | MPEFSOBLCQKHQA-FWAKGOJHSA-N |
6
Targets
6
Activities
1
Assay Types
0
PK Parameters
7
Publications
0
Known Names
Molecular Properties
763.2
MW (Da)
Drug Information
| Molecule Type | Small molecule |
| Availability | Unknown |
| Chirality | Unknown |
Activity Summary
IC50 6 meas. best 6.9
Target Activity Profile
| Target | Type | Best pChEMBL | Mean pChEMBL | Best (nM) | # Data |
|---|---|---|---|---|---|
| A549 CHEMBL392 | IC50 | 6.9 | 6.9 | 126.0 | 1 |
| LoVo CHEMBL614721 | IC50 | 6.47 | 6.47 | 340.0 | 1 |
| NON-PROTEIN TARGET CHEMBL3879801 | IC50 | 6.46 | 6.46 | 346.0 | 1 |
| HCT-15 CHEMBL612263 | IC50 | 6.34 | 6.34 | 454.0 | 1 |
| U373 MG CHEMBL615024 | IC50 | 6.03 | 6.03 | 925.0 | 1 |
| Sodium/potassium-transporting ATPase subunit alpha-1 CHEMBL4131 | IC50 | 5.72 | 5.72 | 1888.0 | 1 |
Activity Data Samples
Top measurements by pChEMBL value
| Target | Type | Rel. | Value | Units | pChEMBL | Assay | PubMed |
|---|---|---|---|---|---|---|---|
| A549 | IC50 | = | 126.0 | nM | 6.9 | Concentration required for 50% growth inhibition of human A549 cancer cell lines... | 15689169 |
| LoVo | IC50 | = | 340.0 | nM | 6.47 | Concentration required for 50% growth inhibition of human LoVo cancer cell lines... | 15689169 |
| NON-PROTEIN TARGET | IC50 | = | 346.0 | nM | 6.46 | Concentration required for 50% growth inhibition of human Hs 683 cancer cell lin... | 15689169 |
| HCT-15 | IC50 | = | 454.0 | nM | 6.34 | Concentration required for 50% growth inhibition of human HCT-15 cancer cell lin... | 15689169 |
| U373 MG | IC50 | = | 925.0 | nM | 6.03 | Concentration required for 50% growth inhibition of human U373 cancer cell lines... | 15689169 |
| Sodium/potassium-transporting ATPase subunit alpha-1 | IC50 | = | 1888.0 | nM | 5.72 | In vitro inhibitory activity against porcine Na+/K+-ATPase | 15689169 |
Literature References
| PubMed | DOI | Target Context | # Activities |
|---|---|---|---|
| 15689169 | 10.1021/jm049405a | NON-PROTEIN TARGET | 1 |
| 15689169 | 10.1021/jm049405a | U373 MG | 1 |
| 15689169 | 10.1021/jm049405a | HCT-15 | 1 |
| 15689169 | 10.1021/jm049405a | LoVo | 1 |
| 15689169 | 10.1021/jm049405a | A549 | 1 |
| 15689169 | 10.1021/jm049405a | Mus musculus | 1 |
| 15689169 | 10.1021/jm049405a | Sodium/potassium-transporting ATPase subunit alpha-1 | 1 |
Data from ChEMBL 36 via Core Engine