Compound Detail
CHEMBL3545083
RGB-286638 Phase I
Enter ChEMBL ID:
Free Research Context
This compound will appear in recent viewed items on the research home for this browser.
Research home
View demo workspace
Phase I
COCCN1CCN(Cc2ccc(-c3n[nH]c4c3C(=O)c3c(NC(=O)NN5CCOCC5)cccc3-4)cc2)CC1
Basic Information
| ChEMBL ID | CHEMBL3545083 |
| Name | RGB-286638 |
| Phase | Phase I |
| Structure Type | MOL |
| InChI Key | XLSYZSRXVVCHLS-UHFFFAOYSA-N |
65
Targets
72
Activities
2
Assay Types
0
PK Parameters
20
Publications
2
Known Names
1
Indications
6
Mechanisms
Molecular Properties
545.6
MW (Da)
2.42
ALogP
8
HBA
3
HBD
115.1
PSA (Ų)
0.31
QED
1
Ro5 Violations
8
Rot. Bonds
Drug Information
| Molecule Type | Small molecule |
| Chirality | Achiral |
Mechanism of Action
| Mechanism | Action Type | Target | Direct | Efficacy |
|---|---|---|---|---|
| Cyclin-dependent kinase 1 inhibitor | INHIBITOR | Cyclin-dependent kinase 1 | ✓ | ✓ |
| Cyclin-dependent kinase 2 inhibitor | INHIBITOR | Cyclin-dependent kinase 2 | ✓ | ✓ |
| Cyclin-dependent kinase 4 inhibitor | INHIBITOR | Cyclin-dependent kinase 4 | ✓ | ✓ |
| Cyclin-dependent kinase 5 inhibitor | INHIBITOR | Cyclin-dependent kinase 5 | ✓ | ✓ |
| Cyclin-dependent kinase 7 inhibitor | INHIBITOR | Cyclin-dependent kinase 7 | ✓ | ✓ |
| Cyclin-dependent kinase 9 inhibitor | INHIBITOR | Cyclin-dependent kinase 9 | ✓ | ✓ |
Indications
Hematologic Neoplasms
Activity Summary
Kd 55 meas. best 8.7
IC50 17 meas. best 9.0
Target Activity Profile
| Target | Type | Best pChEMBL | Mean pChEMBL | Best (nM) | # Data |
|---|---|---|---|---|---|
| Cyclin-dependent kinase 9 CHEMBL3116 | IC50 | 9.0 | 9.0 | 1.0 | 1 |
| CDK9/cyclin T1 CHEMBL2111389 | IC50 | 9.0 | 9.0 | 1.0 | 2 |
| Dual specificity protein kinase CLK4 CHEMBL4203 | Kd | 8.7 | 8.7 | 2.0 | 1 |
| Dual specificity protein kinase CLK1 CHEMBL4224 | Kd | 8.7 | 8.7 | 2.0 | 1 |
| CDK6/cyclin D3 CHEMBL2111448 | IC50 | 8.7 | 8.7 | 2.0 | 1 |
| Cyclin-dependent kinase 7/ cyclin H CHEMBL2111288 | IC50 | 8.7 | 8.7 | 2.0 | 1 |
| CDK3/Cyclin E CHEMBL3038471 | IC50 | 8.7 | 8.7 | 2.0 | 1 |
| Cyclin-dependent kinase 2/cyclin E1 CHEMBL1907605 | IC50 | 8.7 | 8.7 | 2.0 | 1 |
| Cyclin-dependent kinase 1/cyclin B1 CHEMBL1907602 | IC50 | 8.7 | 8.7 | 2.0 | 2 |
| Cyclin-dependent kinase 4/cyclin D1 CHEMBL1907601 | IC50 | 8.7 | 8.55 | 2.0 | 2 |
| Cyclin-dependent kinase 5/CDK5 activator 1 CHEMBL1907600 | IC50 | 8.7 | 8.5 | 2.0 | 2 |
| Cyclin-dependent kinase 1 CHEMBL308 | IC50 | 8.7 | 8.7 | 2.0 | 1 |
| Cyclin-dependent kinase 16 CHEMBL4597 | Kd | 8.52 | 8.52 | 3.0 | 1 |
| Cyclin-dependent kinase 2/cyclin E CHEMBL2094126 | IC50 | 8.52 | 8.52 | 3.0 | 1 |
| Cyclin-dependent kinase 2 CHEMBL301 | IC50 | 8.52 | 8.52 | 3.0 | 1 |
| Cyclin-dependent kinase 4 CHEMBL331 | IC50 | 8.4 | 8.4 | 4.0 | 1 |
| Cyclin-G-associated kinase CHEMBL4355 | Kd | 8.4 | 8.4 | 4.0 | 1 |
| Glycogen synthase kinase-3 alpha CHEMBL2850 | Kd | 8.15 | 8.15 | 7.0 | 1 |
| Casein kinase II subunit alpha' CHEMBL4070 | Kd | 8.1 | 8.1 | 8.0 | 1 |
| Serine/threonine-protein kinase ICK CHEMBL1163126 | Kd | 8.1 | 8.1 | 8.0 | 1 |
| Glycogen synthase kinase-3 beta CHEMBL262 | Kd | 8.1 | 8.1 | 8.0 | 1 |
| BMP-2-inducible protein kinase CHEMBL4522 | Kd | 8.1 | 8.1 | 8.0 | 1 |
| Mitogen-activated protein kinase 10 CHEMBL2637 | Kd | 7.96 | 7.96 | 11.0 | 1 |
| Unchecked CHEMBL612545 | Kd | 7.92 | 7.92 | 12.0 | 1 |
| Dual specificity protein kinase CLK2 CHEMBL4225 | Kd | 7.75 | 7.75 | 18.0 | 1 |
| Uncharacterized protein FLJ45252 CHEMBL4105933 | Kd | 7.66 | 7.66 | 22.0 | 1 |
| AP2-associated protein kinase 1 CHEMBL3830 | Kd | 7.66 | 7.66 | 22.0 | 1 |
| Cyclin-dependent kinase 9 CHEMBL3116 | Kd | 7.48 | 7.48 | 33.0 | 1 |
| Dual specificity tyrosine-phosphorylation-regulated kinase 1A CHEMBL2292 | Kd | 7.47 | 7.47 | 34.0 | 1 |
| Serine/threonine-protein kinase pim-2 CHEMBL4523 | Kd | 7.38 | 7.38 | 42.0 | 1 |
| Cyclin-dependent kinase 2 CHEMBL301 | Kd | 7.14 | 7.14 | 72.0 | 1 |
| TGF-beta receptor type-2 CHEMBL4267 | Kd | 7.1 | 7.1 | 80.0 | 1 |
| Mitogen-activated protein kinase kinase kinase kinase 4 CHEMBL6166 | Kd | 6.9 | 6.9 | 127.0 | 1 |
| Tyrosine-protein kinase JAK1 CHEMBL2835 | Kd | 6.86 | 6.86 | 139.0 | 1 |
| Bone morphogenetic protein receptor type-2 CHEMBL5467 | Kd | 6.82 | 6.82 | 153.0 | 1 |
| Cyclin-dependent kinase 7 CHEMBL3055 | Kd | 6.81 | 6.81 | 154.0 | 1 |
| Serine/threonine-protein kinase D2 CHEMBL4900 | Kd | 6.71 | 6.71 | 195.0 | 1 |
| Serine/threonine-protein kinase SIK2 CHEMBL5699 | Kd | 6.68 | 6.68 | 207.0 | 1 |
| Mitogen-activated protein kinase kinase kinase 11 CHEMBL2708 | Kd | 6.58 | 6.58 | 265.0 | 1 |
| Serine/threonine-protein kinase D3 CHEMBL2595 | Kd | 6.53 | 6.53 | 297.0 | 1 |
| Cyclin-dependent kinase 5 CHEMBL4036 | Kd | 6.5 | 6.5 | 318.0 | 1 |
| Receptor-type tyrosine-protein kinase FLT3 CHEMBL1974 | Kd | 6.49 | 6.49 | 323.0 | 1 |
| Mitogen-activated protein kinase 9 CHEMBL4179 | Kd | 6.43 | 6.43 | 370.0 | 1 |
| General transcription and DNA repair factor IIH helicase subunit XPD CHEMBL4105743 | Kd | 6.34 | 6.34 | 456.0 | 1 |
| Serine/threonine-protein kinase 16 CHEMBL3938 | Kd | 6.29 | 6.29 | 515.0 | 1 |
| Dual specificity mitogen-activated protein kinase kinase 5 CHEMBL4948 | Kd | 6.27 | 6.27 | 535.0 | 1 |
| Mitogen-activated protein kinase 8 CHEMBL2276 | Kd | 6.14 | 6.14 | 731.0 | 1 |
| Citron Rho-interacting kinase CHEMBL5579 | Kd | 6.12 | 6.12 | 763.0 | 1 |
| Cyclin-dependent kinase 12 CHEMBL3559692 | Kd | 6.02 | 6.02 | 947.0 | 1 |
| Cyclin-dependent kinase 13 CHEMBL1795192 | Kd | 6.0 | 6.0 | 1012.0 | 1 |
Activity Data Samples
Top measurements by pChEMBL value
Literature References
| PubMed | DOI | Target Context | # Activities |
|---|---|---|---|
| 29191878 | 10.1126/science.aan4368 | Unchecked | 5 |
| - | 10.6019/CHEMBL4495565 | SARS-CoV-2 | 4 |
| - | 10.6019/CHEMBL4495564 | Replicase polyprotein 1ab | 2 |
| - | 10.6019/CHEMBL4808148 | Histone deacetylase 6 | 2 |
| 29191878 | 10.1126/science.aan4368 | Tyrosine-protein kinase ABL2 | 1 |
| 29191878 | 10.1126/science.aan4368 | Actin-related protein 3 | 1 |
| 29191878 | 10.1126/science.aan4368 | Actin-related protein 2 | 1 |
| 29191878 | 10.1126/science.aan4368 | Peroxisomal acyl-coenzyme A oxidase 3 | 1 |
| 29191878 | 10.1126/science.aan4368 | Peroxisomal acyl-coenzyme A oxidase 1 | 1 |
| 29191878 | 10.1126/science.aan4368 | Very long-chain specific acyl-CoA dehydrogenase, mitochondrial | 1 |
| 29191878 | 10.1126/science.aan4368 | Acyl-CoA dehydrogenase family member 11 | 1 |
| 29191878 | 10.1126/science.aan4368 | Acyl-CoA dehydrogenase family member 10 | 1 |
| - | 10.6019/EOS300108 | HepG2 | 1 |
| 29191878 | 10.1126/science.aan4368 | AP2-associated protein kinase 1 | 1 |
| 27171036 | 10.1021/acs.jmedchem.6b00150 | Cyclin-dependent kinase 1/cyclin B1 | 1 |
| 27171036 | 10.1021/acs.jmedchem.6b00150 | Cyclin-dependent kinase 4/cyclin D1 | 1 |
| 27171036 | 10.1021/acs.jmedchem.6b00150 | CDK9/cyclin T1 | 1 |
| 27171036 | 10.1021/acs.jmedchem.6b00150 | Cyclin-dependent kinase 2/cyclin E1 | 1 |
| 27171036 | 10.1021/acs.jmedchem.6b00150 | CDK3/Cyclin E | 1 |
| 27171036 | 10.1021/acs.jmedchem.6b00150 | Cyclin-dependent kinase 5/CDK5 activator 1 | 1 |
Data from ChEMBL 36 via Core Engine